For research use only. Not for therapeutic Use.
2-(Benzyloxy)-4-methylbenzaldehyde（Cat No.:L025451）is a valuable aromatic aldehyde used in organic synthesis, particularly in the development of pharmaceuticals and fine chemicals. Its structure, featuring a benzyloxy group and a methyl substitution, offers unique reactivity that enables the creation of diverse molecular frameworks. This compound is often employed in the synthesis of complex intermediates, including those used in drug discovery and development. Its versatility and stability make it a preferred choice for chemists working on advanced organic reactions, contributing to the efficient design of new therapeutic agents.
| Catalog Number | L025451 |
| CAS Number | 154478-35-0 |
| Molecular Formula | C15H14O2 |
| Purity | ≥95% |
| IUPAC Name | 4-methyl-2-phenylmethoxybenzaldehyde |
| InChI | InChI=1S/C15H14O2/c1-12-7-8-14(10-16)15(9-12)17-11-13-5-3-2-4-6-13/h2-10H,11H2,1H3 |
| InChIKey | QXWUEDBTGJKGJV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C=O)OCC2=CC=CC=C2 |
