For research use only. Not for therapeutic Use.
2-Benzyloxy-5-bromo-6-methylpyridine is a substituted pyridine derivative characterized by a benzyloxy group, a bromine atom, and a methyl group on the pyridine ring. This compound is valuable in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The bromine substituent enhances its reactivity, allowing for various functionalization reactions. Researchers explore its potential biological activities and applications in medicinal chemistry, particularly in designing novel compounds with improved efficacy and specificity for various therapeutic targets.
CAS Number | 126717-60-0 |
Molecular Formula | C13H12BrNO |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | 3-bromo-2-methyl-6-phenylmethoxypyridine |
InChI | InChI=1S/C13H12BrNO/c1-10-12(14)7-8-13(15-10)16-9-11-5-3-2-4-6-11/h2-8H,9H2,1H3 |
InChIKey | RBXCAMWLXQQRPW-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC(=N1)OCC2=CC=CC=C2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |