For research use only. Not for therapeutic Use.
(2-Benzyloxycarbonylamino-ethyl)-carbamic acid benzyl ester(Cat No.:L025397)is a high-purity compound commonly used in pharmaceutical and chemical research, particularly in peptide synthesis. This molecule features a benzyloxycarbonyl (Cbz) protecting group on the amino-ethyl side chain and a benzyl ester protecting group on the carbamic acid, making it an essential intermediate in the synthesis of complex peptides and organic molecules. Its structure allows for selective reactivity, facilitating the creation of custom peptides. (2-Benzyloxycarbonylamino-ethyl)-carbamic acid benzyl ester is ideal for precise synthetic applications in medicinal chemistry.
CAS Number | 18807-67-5 |
Molecular Formula | C18H20N2O4 |
Purity | ≥95% |
IUPAC Name | benzyl N-[2-(phenylmethoxycarbonylamino)ethyl]carbamate |
InChI | InChI=1S/C18H20N2O4/c21-17(23-13-15-7-3-1-4-8-15)19-11-12-20-18(22)24-14-16-9-5-2-6-10-16/h1-10H,11-14H2,(H,19,21)(H,20,22) |
InChIKey | WVZPWYPJUMOHPS-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)COC(=O)NCCNC(=O)OCC2=CC=CC=C2 |