For research use only. Not for therapeutic Use.
2-Benzyltoluene（Cat No.:L006847）, also known as α-ethylbenzylbenzene, is an aromatic compound. Its molecular structure consists of a toluene molecule with a benzyl group attached at the 2nd position. This compound is utilized in the chemical industry as a versatile building block in the synthesis of various organic compounds, including pharmaceuticals, dyes, and fragrances. Its specific arrangement of atoms allows for diverse chemical transformations, making it valuable in the creation of specialized chemicals.
| Catalog Number | L006847 |
| CAS Number | 713-36-0 |
| Molecular Formula | C14H14 |
| Purity | ≥95% |
| IUPAC Name | 1-benzyl-2-methylbenzene |
| InChI | InChI=1S/C14H14/c1-12-7-5-6-10-14(12)11-13-8-3-2-4-9-13/h2-10H,11H2,1H3 |
| InChIKey | PQTAUFTUHHRKSS-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1CC2=CC=CC=C2 |
