For research use only. Not for therapeutic Use.
2-Biphenyl-(2′-methoxy)carboxylic acid is an organic compound featuring a biphenyl structure with a methoxy group attached to one ring and a carboxylic acid group attached to the other. It is commonly used in pharmaceutical research and organic synthesis as an intermediate for the development of bioactive molecules. This compound’s structure allows for versatile chemical modifications, making it valuable for creating drug candidates, agrochemicals, and materials. Its reactivity and stability contribute to advancements in medicinal chemistry and the synthesis of complex organic compounds.
CAS Number | 17296-28-5 |
Synonyms | 2-(2-Methoxyphenyl)benzoic acid |
Molecular Formula | C14H12O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(2-methoxyphenyl)benzoic acid |
InChI | InChI=1S/C14H12O3/c1-17-13-9-5-4-7-11(13)10-6-2-3-8-12(10)14(15)16/h2-9H,1H3,(H,15,16) |
InChIKey | DONMCRNZWAMEGC-UHFFFAOYSA-N |
SMILES | COC1=CC=CC=C1C2=CC=CC=C2C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |