For research use only. Not for therapeutic Use.
2-(Bis(2-(tert-butoxy)-2-oxoethyl)amino)acetic acid（Cat No.:M130382）is a compound characterized by a glycine backbone with two N-substituted tert-butyl ester groups. This structure suggests its potential use as a protected amino acid derivative in peptide synthesis, where the tert-butyl groups serve as protecting moieties for carboxyl functionalities. Such protecting groups are commonly employed to prevent undesired reactions during synthetic processes. Proper handling and storage in a cool, dry place are essential to maintain the compound’s stability and reactivity.
| CAS Number | 171557-31-6 |
| Synonyms | 2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetic acid |
| Molecular Formula | C14H25NO6 |
| Purity | ≥95% |
| IUPAC Name | 2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetic acid |
| InChI | InChI=1S/C14H25NO6/c1-13(2,3)20-11(18)8-15(7-10(16)17)9-12(19)21-14(4,5)6/h7-9H2,1-6H3,(H,16,17) |
| InChIKey | DEUFNPOTWJNGNL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CN(CC(=O)O)CC(=O)OC(C)(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
