For research use only. Not for therapeutic Use.
2-Bromo-1-(4-chloro-2-methoxyphenyl)ethanone (Cat.No:L003470) is a crucial intermediate in organic synthesis. Its unique structure combines bromine, chlorine, and methoxyphenyl moieties, making it valuable in the creation of diverse chemical compounds. This compound finds applications in pharmaceutical and agrochemical industries, serving as a versatile building block.
Catalog Number | L003470 |
CAS Number | 60208-06-2 |
Molecular Formula | C9H8BrClO2 |
Purity | ≥95% |
IUPAC Name | 2-bromo-1-(4-chloro-2-methoxyphenyl)ethanone |
InChI | InChI=1S/C9H8BrClO2/c1-13-9-4-6(11)2-3-7(9)8(12)5-10/h2-4H,5H2,1H3 |
InChIKey | FDGIQMRTLABTHW-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC(=C1)Cl)C(=O)CBr |