For research use only. Not for therapeutic Use.
2-Bromo-1-(4-chlorophenyl)ethylene is an organic compound featuring a bromine atom attached to an ethylene group, with a 4-chlorophenyl group connected to the ethylene backbone. This compound is often used as an intermediate in the synthesis of more complex organic molecules, particularly in the pharmaceutical and agrochemical industries. The presence of both bromine and chlorine atoms provides sites for further chemical reactions, such as substitution or coupling reactions, making it a valuable building block in the development of bioactive compounds and other specialized chemicals.
CAS Number | 125428-11-7 |
Synonyms | 1-(2-Bromoethenyl)-4-chloro-benzene; 1-(2-Bromoethenyl)-4-chlorobenzene; β-Bromo-4-chlorostyrene; |
Molecular Formula | C₈H₆BrCl |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-(2-bromoethenyl)-4-chlorobenzene |
InChI | InChI=1S/C8H6BrCl/c9-6-5-7-1-3-8(10)4-2-7/h1-6H |
InChIKey | ZTBMGKTZOOAZBH-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C=CBr)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |