For research use only. Not for therapeutic Use.
2-Bromo-1-(chloromethyl)-4-(trifluoromethyl)benzene(Cat No.:L006687), is a complex chemical compound featuring a benzene ring substituted with bromine, chloromethyl, and trifluoromethyl groups. This intricate structure offers unique reactivity, making it valuable in organic synthesis and chemical research. Compounds with trifluoromethyl groups often possess enhanced biological and chemical properties, making them important in drug development and materials science. The presence of both bromine and chloromethyl groups adds to its versatility, allowing for various synthetic pathways. Researchers leverage its distinct properties for designing specific molecules, contributing significantly to advancements in medicinal chemistry and the development of novel materials.
CAS Number | 480438-96-8 |
Molecular Formula | C8H5BrClF3 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 2-bromo-1-(chloromethyl)-4-(trifluoromethyl)benzene |
InChI | InChI=1S/C8H5BrClF3/c9-7-3-6(8(11,12)13)2-1-5(7)4-10/h1-3H,4H2 |
InChIKey | FFTAVZITFBFVEC-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C(F)(F)F)Br)CCl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |