For research use only. Not for therapeutic Use.
2-Bromo-1-(trifluoromethyl)-4-fluorobenzene(Cat No.:L006848), is an organic compound with a molecular structure consisting of a benzene ring bearing bromine, fluorine, and difluoromethyl (CF2H) groups. This compound serves as a valuable intermediate in the synthesis of complex organic molecules, particularly in medicinal and agrochemical research. Chemists use its unique fluorinated and brominated functionalities to introduce specific reactivity in various chemical reactions, enabling the creation of diverse bioactive compounds and specialty chemicals.
CAS Number | 845866-81-1 |
Molecular Formula | C7H4BrF3 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 2-bromo-1-(difluoromethyl)-4-fluorobenzene |
InChI | InChI=1S/C7H4BrF3/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3,7H |
InChIKey | WAJOYKZVIXCVTR-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1F)Br)C(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |