For research use only. Not for therapeutic Use.
2-Bromo-1-iodonaphthalene(CAT: L000202) is a significant compound in organic chemistry, particularly in the field of synthesis. It acts as a versatile building block in the creation of various organic molecules, including pharmaceutical intermediates and agrochemicals. Its dual halogen substitution pattern provides unique reactivity and selectivity, making it valuable for modifying molecular structures.
CAS Number | 676267-05-3 |
Molecular Formula | C10H6BrI |
Purity | ≥95% |
IUPAC Name | 2-bromo-1-iodonaphthalene |
InChI | InChI=1S/C10H6BrI/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6H |
InChIKey | QAFFBUBNQSNVSZ-UHFFFAOYSA-N |