For research use only. Not for therapeutic Use.
2-Bromo-1-methoxy-3-methylbenzene(Cat No.:L035869), also known as 2-bromo-3-methyl anisole, is a brominated aromatic compound characterized by a methoxy and a methyl group on a benzene ring. This molecular configuration enhances its utility in organic synthesis, particularly in the formation of more complex pharmaceutical and agrochemical molecules through various substitution reactions. The bromine atom serves as an active site for further functionalization, while the methoxy and methyl groups modify the electronic properties of the ring, increasing its reactivity and solubility. This compound is essential in synthesizing new materials with specific chemical properties.
CAS Number | 38197-43-2 |
Molecular Formula | C8H9BrO |
Purity | ≥95% |
IUPAC Name | 2-bromo-1-methoxy-3-methylbenzene |
InChI | InChI=1S/C8H9BrO/c1-6-4-3-5-7(10-2)8(6)9/h3-5H,1-2H3 |
InChIKey | ZPXCHEDAXFJYBZ-UHFFFAOYSA-N |
SMILES | CC1=C(C(=CC=C1)OC)Br |