For research use only. Not for therapeutic Use.
(2′-Bromo-[1,1′-biphenyl]-2-yl)boronic acid(Cat No.:L007381), is a significant chemical compound in the realm of organic synthesis. This boronic acid derivative features a brominated biphenyl structure, enhancing its reactivity and versatility in various chemical reactions. Scientists and researchers utilize this compound as a key building block in Suzuki-Miyaura cross-coupling reactions, a fundamental method for constructing carbon-carbon bonds in organic synthesis. This versatile compound serves as a crucial component for creating complex organic molecules, enabling advancements in the fields of pharmaceuticals, materials science, and agrochemicals.
CAS Number | 1089189-34-3 |
Molecular Formula | C12H10BBrO2 |
Purity | ≥95% |
IUPAC Name | [2-(2-bromophenyl)phenyl]boronic acid |
InChI | InChI=1S/C12H10BBrO2/c14-12-8-4-2-6-10(12)9-5-1-3-7-11(9)13(15)16/h1-8,15-16H |
InChIKey | BXYVFENPSFGAIM-UHFFFAOYSA-N |
SMILES | B(C1=CC=CC=C1C2=CC=CC=C2Br)(O)O |