For research use only. Not for therapeutic Use.
2-Bromo-1,4-dimethyl-1H-imidazole-5-carboxylic acid (Cat.No:L003325) is a crucial chemical compound used in pharmaceutical research. Its unique structure is integral in the synthesis of innovative pharmaceuticals, contributing to the development of cutting-edge drugs and therapies.
CAS Number | 1782559-23-2 |
Molecular Formula | C6H7BrN2O2 |
Purity | ≥95% |
IUPAC Name | 2-bromo-3,5-dimethylimidazole-4-carboxylic acid |
InChI | InChI=1S/C6H7BrN2O2/c1-3-4(5(10)11)9(2)6(7)8-3/h1-2H3,(H,10,11) |
InChIKey | WJWWTHYHCNGWAH-UHFFFAOYSA-N |
SMILES | CC1=C(N(C(=N1)Br)C)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |