For research use only. Not for therapeutic Use.
2-Bromo-2-methylpropiophenone (Cat No.:M063949) is a chemical compound. It features a phenyl ring with a bromine atom and a methyl group attached to a carbonyl group. This compound is important in organic synthesis and chemical research as a versatile building block. Its bromine and carbonyl functionalities provide reactivity for various reactions, including nucleophilic substitutions and transformations. Its role as an intermediate contributes to the creation of diverse molecules with specific functionalities, serving applications in drug discovery, materials science, and other chemical industries. The compound’s structure and reactivity enhance its significance in synthetic strategies and research.
CAS Number | 10409-54-8 |
Molecular Formula | C10H11BrO |
Purity | ≥95% |
Storage | Store at +4 °C |
IUPAC Name | 2-bromo-2-methyl-1-phenylpropan-1-one |
InChI | InChI=1S/C10H11BrO/c1-10(2,11)9(12)8-6-4-3-5-7-8/h3-7H,1-2H3 |
InChIKey | QMOSZSHTSOWPRX-UHFFFAOYSA-N |
SMILES | CC(C)(C(=O)C1=CC=CC=C1)Br |