For research use only, not for therapeutic use.
2-bromo-3-chloro-5H-pyrrolo[2,3-b]pyrazine(Cat No.:L007161), is a chemical compound with the molecular formula C6H3BrClN3. It features a pyrrolopyrazine ring—a bicyclic structure containing nitrogen atoms—with bromine at the 2nd position and chlorine at the 3rd position. This compound is vital in medicinal chemistry and drug discovery research, serving as a key intermediate in the synthesis of diverse biologically active molecules, including potential pharmaceuticals. Its unique structure and reactivity enable its application in the development of novel drugs, contributing significantly to advancements in therapeutic research and the discovery of new chemical entities for various biological targets.
Catalog Number | L007161 |
CAS Number | 1569514-98-2 |
Molecular Formula | C6H3BrClN3 |
Purity | ≥95% |
IUPAC Name | 2-bromo-3-chloro-5H-pyrrolo[2,3-b]pyrazine |
InChI | InChI=1S/C6H3BrClN3/c7-4-5(8)11-6-3(10-4)1-2-9-6/h1-2H,(H,9,11) |
InChIKey | HSMNZAAANMEUSY-UHFFFAOYSA-N |
SMILES | C1=CNC2=C1N=C(C(=N2)Cl)Br |