For research use only. Not for therapeutic Use.
2-Bromo-3-chlorotoluene(Cat No.:L022323)is a versatile compound used in organic synthesis and pharmaceutical research. Featuring bromine and chlorine substituents on a toluene ring, this halogenated aromatic compound is an important intermediate for developing complex molecules, including agrochemicals and potential therapeutic agents. Its structure allows for selective reactivity, making it valuable in various chemical transformations and cross-coupling reactions. With high purity and consistent quality, 2-Bromo-3-chlorotoluene supports the efficient synthesis of advanced materials and bioactive compounds in medicinal chemistry and related fields.
Catalog Number | L022323 |
CAS Number | 69190-56-3 |
Molecular Formula | C7H6BrCl |
Purity | ≥95% |
IUPAC Name | 2-bromo-1-chloro-3-methylbenzene |
InChI | InChI=1S/C7H6BrCl/c1-5-3-2-4-6(9)7(5)8/h2-4H,1H3 |
InChIKey | ADSIBTDRKLGGEO-UHFFFAOYSA-N |
SMILES | CC1=C(C(=CC=C1)Cl)Br |