For research use only. Not for therapeutic Use.
2-Bromo-3-fluoro-4-formylpyridine(Cat No.:M015286)is a valuable heterocyclic compound used in organic synthesis, particularly in pharmaceutical and agrochemical research. This pyridine derivative features a bromine, fluorine, and formyl group, which provide diverse reactivity, enabling the formation of complex molecular architectures. It serves as a key intermediate in the synthesis of biologically active molecules, where the unique combination of halogen and formyl functionalities allows for selective modifications. Its role in the creation of novel compounds underscores its importance in medicinal chemistry and advanced material science.
CAS Number | 1227572-94-2 |
Molecular Formula | C6H5BrFNO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-bromo-3-fluoropyridine-4-carbaldehyde |
InChI | InChI=1S/C6H3BrFNO/c7-6-5(8)4(3-10)1-2-9-6/h1-3H |
InChIKey | WXWCXVNMFZTDCP-UHFFFAOYSA-N |
SMILES | C1=CN=C(C(=C1C=O)F)Br |