For research use only. Not for therapeutic Use.
2-Bromo-3-fluoro-6-hydroxybenzaldehyde(CAT: L002762) is a high-purity aromatic compound featuring bromine, fluorine, hydroxy, and aldehyde functional groups on a benzene ring. This versatile molecule is widely utilized in pharmaceutical and chemical research as a building block for synthesizing bioactive compounds, intermediates, and advanced materials. The aldehyde functionality enables nucleophilic addition and condensation reactions, while the bromine and fluorine atoms enhance its reactivity for cross-coupling transformations. The hydroxy group adds further versatility, facilitating derivatization and structural modification. With reliable stability and consistent quality, 2-Bromo-3-fluoro-6-hydroxybenzaldehyde is an essential reagent for medicinal chemistry and synthetic organic chemistry applications.
CAS Number | 1427382-15-7 |
Molecular Formula | C7H4BrFO2 |
Purity | ≥95% |
IUPAC Name | 2-bromo-3-fluoro-6-hydroxybenzaldehyde |
InChI | InChI=1S/C7H4BrFO2/c8-7-4(3-10)6(11)2-1-5(7)9/h1-3,11H |
InChIKey | HRMRQEBLDLBPEG-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1O)C=O)Br)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |