For research use only. Not for therapeutic Use.
2-Bromo-3-fluorophenol (Cat No.:R022041) is a chemical compound. It features a phenol ring substituted with both bromine and fluorine atoms. This compound is used in organic synthesis and chemical research for its potential reactivity in various reactions. Its bromine and fluorine substituents contribute to its versatility, allowing it to participate in diverse transformations, including nucleophilic substitutions and coupling reactions. Its role as a reagent and building block adds to its significance in creating complex molecules for applications in pharmaceuticals, agrochemicals, and materials science, contributing to advancements in synthetic chemistry and research.
CAS Number | 443-81-2 |
Molecular Formula | C6H4BrFO |
Purity | ≥95% |
Storage | Inert atmosphere,Room Temperature |
IUPAC Name | 2-bromo-3-fluorophenol |
InChI | InChI=1S/C6H4BrFO/c7-6-4(8)2-1-3-5(6)9/h1-3,9H |
InChIKey | LMFRSLRJXLATRL-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)F)Br)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |