For research use only. Not for therapeutic Use.
2-Bromo-3-hydroxy-6-iodopyridine is a halogenated pyridine derivative used in pharmaceutical research and organic synthesis. With both bromine and iodine atoms attached to the pyridine ring, along with a hydroxyl group at the 3-position, this compound offers significant versatility for chemical modifications. It serves as a key intermediate in the synthesis of bioactive molecules and complex heterocyclic structures. Its unique reactivity makes it valuable in medicinal chemistry for developing therapeutic agents, contributing to the advancement of drug discovery and material sciences.
CAS Number | 129611-32-1 |
Molecular Formula | C5H3BrINO |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 2-bromo-6-iodopyridin-3-ol |
InChI | InChI=1S/C5H3BrINO/c6-5-3(9)1-2-4(7)8-5/h1-2,9H |
InChIKey | IQUADFAYJOJQJA-UHFFFAOYSA-N |
SMILES | C1=CC(=NC(=C1O)Br)I |