For research use only. Not for therapeutic Use.
2-Bromo-3,4-difluoroaniline(Cat No.:L012580)is a halogenated aromatic amine used as a key intermediate in organic synthesis, particularly in the pharmaceutical and agrochemical industries. This compound features a bromine atom at the 2-position and fluorine atoms at the 3- and 4-positions of the aniline ring, making it highly reactive for further chemical modifications. It is commonly employed in the synthesis of complex molecules, including potential drug candidates and bioactive compounds. With its unique substitution pattern, 2-Bromo-3,4-difluoroaniline supports innovative research in medicinal chemistry and material science.
CAS Number | 1092349-87-5 |
Molecular Formula | C6H4BrF2N |
Purity | ≥95% |
IUPAC Name | 2-bromo-3,4-difluoroaniline |
InChI | InChI=1S/C6H4BrF2N/c7-5-4(10)2-1-3(8)6(5)9/h1-2H,10H2 |
InChIKey | ZGZURPPCPVPDMX-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1N)Br)F)F |