For research use only. Not for therapeutic Use.
2-Bromo-4-(4-methylpiperazin-1-yl)aniline(Cat No.:L007455), is a chemical compound with the molecular formula C11H16BrN3. This compound contains a bromine atom and a 4-methylpiperazin-1-yl group attached to a phenyl ring. Compounds featuring piperazine moieties are significant in medicinal chemistry, often serving as key structural elements in pharmaceuticals, particularly in psychiatric and neurological medications. The bromine substituent enhances the compound’s reactivity, making it valuable in various chemical syntheses.
Catalog Number | L007455 |
CAS Number | 166818-86-6 |
Molecular Formula | C11H16BrN3 |
Purity | ≥95% |
IUPAC Name | 2-bromo-4-(4-methylpiperazin-1-yl)aniline |
InChI | InChI=1S/C11H16BrN3/c1-14-4-6-15(7-5-14)9-2-3-11(13)10(12)8-9/h2-3,8H,4-7,13H2,1H3 |
InChIKey | LFYUFSZCTMVRAQ-UHFFFAOYSA-N |
SMILES | CN1CCN(CC1)C2=CC(=C(C=C2)N)Br |