For research use only. Not for therapeutic Use.
2-Bromo-4-chlorothiazole(CAT: L034048) is a high-purity heterocyclic compound featuring bromine and chlorine substituents on a thiazole ring. This versatile molecule serves as a valuable intermediate in pharmaceutical and agrochemical research, enabling the synthesis of bioactive compounds and complex organic frameworks. Its unique reactivity and well-defined structure make it particularly useful in medicinal chemistry for exploring innovative therapeutic pathways. With excellent stability and precise composition, 2-Bromo-4-chlorothiazole ensures consistent and reliable performance, making it an indispensable tool for researchers focused on drug discovery, fine chemical production, and advanced synthetic applications.
CAS Number | 139670-03-4 |
Molecular Formula | C3HBrClNS |
Purity | ≥95% |
IUPAC Name | 2-bromo-4-chloro-1,3-thiazole |
InChI | InChI=1S/C3HBrClNS/c4-3-6-2(5)1-7-3/h1H |
InChIKey | WOUPIOIURYZNRU-UHFFFAOYSA-N |
SMILES | C1=C(N=C(S1)Br)Cl |