For research use only. Not for therapeutic Use.
2-Bromo-4-ethoxy-1-methylbenzene (Cat.No:L003555) is a crucial organic compound with diverse applications in pharmaceutical and agrochemical industries. Its unique structure, featuring a bromine atom and an ethoxy group, imparts distinctive reactivity. This compound serves as a valuable intermediate in the synthesis of specialized chemicals.
CAS Number | 1445601-62-6 |
Molecular Formula | C9H11BrO |
Purity | ≥95% |
IUPAC Name | 2-bromo-4-ethoxy-1-methylbenzene |
InChI | InChI=1S/C9H11BrO/c1-3-11-8-5-4-7(2)9(10)6-8/h4-6H,3H2,1-2H3 |
InChIKey | GNTXPUQREWIXOK-UHFFFAOYSA-N |
SMILES | CCOC1=CC(=C(C=C1)C)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |