For research use only. Not for therapeutic Use.
2-Bromo-4′-fluoro-1,1′-biphenyl(Cat No.:L043024)is a high-purity halogenated biphenyl compound widely used in pharmaceutical research and organic synthesis. Featuring a bromine atom at the 2-position and a fluorine atom at the 4′-position, this compound is essential for creating complex organic molecules, particularly in the development of pharmaceuticals, agrochemicals, and advanced materials. Its unique structure makes it a valuable building block in cross-coupling reactions, facilitating the synthesis of diverse aromatic compounds. 2-Bromo-4′-fluoro-1,1′-biphenyl ensures reliability and precision in demanding synthetic applications.
CAS Number | 89346-54-3 |
Molecular Formula | C12H8BrF |
Purity | ≥95% |
IUPAC Name | 1-bromo-2-(4-fluorophenyl)benzene |
InChI | InChI=1S/C12H8BrF/c13-12-4-2-1-3-11(12)9-5-7-10(14)8-6-9/h1-8H |
InChIKey | RYODPXPHDPGULP-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)F)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |