For research use only. Not for therapeutic Use.
2-Bromo-4-iodo-benzoic acid methyl ester(CAT: L000194) is a crucial compound in organic chemistry. It acts as a versatile building block for the synthesis of various pharmaceutical agents and organic compounds. This compound is employed in the development of novel drug candidates due to its role in modifying molecular structures, enhancing bioavailability, and promoting specific biological interactions.
CAS Number | 1261588-35-5 |
Molecular Formula | C8H6BrIO2 |
Purity | ≥95% |
IUPAC Name | methyl 2-bromo-4-iodobenzoate |
InChI | InChI=1S/C8H6BrIO2/c1-12-8(11)6-3-2-5(10)4-7(6)9/h2-4H,1H3 |
InChIKey | AGPATUQJKLIKMY-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |