For research use only. Not for therapeutic Use.
2-Bromo-4-iodoaniline(CAT: L017304) is a high-purity halogenated aromatic compound featuring a bromo group at the 2-position, an iodo group at the 4-position, and an amino group (-NH₂) on a benzene ring. This versatile molecule is widely used as a key intermediate in pharmaceutical research and organic synthesis, particularly for the development of bioactive compounds and functionalized heterocycles. The combination of bromine and iodine substituents enables selective functionalization through cross-coupling reactions (e.g., Suzuki-Miyaura or Sonogashira couplings), facilitating the construction of complex molecular frameworks. 2-Bromo-4-iodoaniline offers excellent reactivity and stability, making it essential for medicinal chemistry and advanced material science applications.
CAS Number | 29632-73-3 |
Molecular Formula | C6H5BrIN |
Purity | ≥95% |
IUPAC Name | 2-bromo-4-iodoaniline |
InChI | InChI=1S/C6H5BrIN/c7-5-3-4(8)1-2-6(5)9/h1-3H,9H2 |
InChIKey | HHWOYRKNRZSNQE-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1I)Br)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |