For research use only. Not for therapeutic Use.
2-Bromo-4-methoxynicotinonitrile(CAT: L031526) is a high-purity heterocyclic compound featuring a bromine atom at the 2-position, a methoxy group at the 4-position, and a nitrile functional group on a nicotinonitrile ring. This versatile molecule is widely used as an intermediate in pharmaceutical and organic synthesis, particularly in the development of bioactive compounds such as kinase inhibitors, receptor modulators, and other therapeutic agents. Its unique structure and reactivity make it suitable for advanced chemical transformations, including nucleophilic substitution reactions. 2-Bromo-4-methoxynicotinonitrile is an essential building block for research in medicinal chemistry, fine chemical production, and material science applications.
CAS Number | 98645-42-2 |
Molecular Formula | C7H5BrN2O |
Purity | ≥95% |
IUPAC Name | 2-bromo-4-methoxypyridine-3-carbonitrile |
InChI | InChI=1S/C7H5BrN2O/c1-11-6-2-3-10-7(8)5(6)4-9/h2-3H,1H3 |
InChIKey | HQAHXRSUIVBUOU-UHFFFAOYSA-N |
SMILES | COC1=C(C(=NC=C1)Br)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |