For research use only. Not for therapeutic Use.
2-Bromo-4-methyl-1-(trifluoromethoxy)benzene(Cat No.:L033012)is an aromatic compound characterized by the presence of a bromine atom at the 2-position, a methyl group at the 4-position, and a trifluoromethoxy group on the benzene ring. This compound is used as an intermediate in organic synthesis, particularly in the pharmaceutical and agrochemical industries. The trifluoromethoxy group enhances the compound’s lipophilicity and metabolic stability, while the bromine atom allows for further functionalization through various coupling reactions. Its structure is valuable for designing bioactive molecules and advanced materials.
CAS Number | 887268-25-9 |
Molecular Formula | C8H6BrF3O |
Purity | ≥95% |
IUPAC Name | 2-bromo-4-methyl-1-(trifluoromethoxy)benzene |
InChI | InChI=1S/C8H6BrF3O/c1-5-2-3-7(6(9)4-5)13-8(10,11)12/h2-4H,1H3 |
InChIKey | ZDOAHMKYIMHORO-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1)OC(F)(F)F)Br |