For research use only. Not for therapeutic Use.
2-Bromo-4-methyl-6-nitroaniline(Cat No.:L021743)is an important compound in pharmaceutical research and organic synthesis, characterized by a bromine atom, a methyl group, and a nitro group on an aniline ring. This compound serves as a key intermediate in the development of various bioactive molecules, including potential therapeutic agents. Its structure allows for selective reactivity, making it valuable in the synthesis of complex aromatic and heterocyclic compounds. High purity and stability ensure consistent performance in research applications, supporting advanced medicinal chemistry and the discovery of innovative drugs.
CAS Number | 827-24-7 |
Molecular Formula | C7H7BrN2O2 |
Purity | ≥95% |
IUPAC Name | 2-bromo-4-methyl-6-nitroaniline |
InChI | InChI=1S/C7H7BrN2O2/c1-4-2-5(8)7(9)6(3-4)10(11)12/h2-3H,9H2,1H3 |
InChIKey | VFPKZASVVCBVMG-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C(=C1)Br)N)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |