For research use only. Not for therapeutic Use.
2-Bromo-4’-methylpropiophenone (Cat.No:R012637) is a key chemical intermediate known for its versatile applications in pharmaceutical and chemical synthesis. Its unique structure makes it valuable in the production of various compounds, including pharmaceuticals, agrochemicals, and advanced materials. 2-Bromo-4’-methylpropiophenone plays a crucial role in the synthesis of complex molecules.
Catalog Number | R012637 |
CAS Number | 1451-82-7 |
Synonyms | 2-Bromo-1-(4-methylphenyl)-1-propanone; 4-Methylphenyl 1-Bromoethyl Ketone; |
Molecular Formula | C10H11BrO |
Purity | ≥95% |
Storage | Store at -20°C |
Related CAS | 3457-48-5 6941-17-9 611-97-2 1218-89-9 |
IUPAC Name | 2-bromo-1-(4-methylphenyl)propan-1-one |
InChI | InChI=1S/C10H11BrO/c1-7-3-5-9(6-4-7)10(12)8(2)11/h3-6,8H,1-2H3 |
InChIKey | OZLUPIIIHOOPNQ-UHFFFAOYSA-N |
SMILES | CC1=CC=C(C=C1)C(=O)C(C)Br |