For research use only. Not for therapeutic Use.
2-Bromo-4′-nitroacetophenone(Cat No.:L011290)is an aromatic compound used as a key intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. It features a bromine atom at the 2-position and a nitro group at the 4′-position of the acetophenone ring, making it highly reactive for various chemical modifications. This compound is valuable for creating complex molecules, including potential drug candidates and active ingredients. Its structure allows for versatile applications in medicinal chemistry, facilitating the synthesis of bioactive compounds and advanced chemical products.
CAS Number | 99-81-0 |
Molecular Formula | C8H6BrNO3 |
Purity | ≥95% |
IUPAC Name | 2-bromo-1-(4-nitrophenyl)ethanone |
InChI | InChI=1S/C8H6BrNO3/c9-5-8(11)6-1-3-7(4-2-6)10(12)13/h1-4H,5H2 |
InChIKey | MBUPVGIGAMCMBT-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C(=O)CBr)[N+](=O)[O-] |