For research use only. Not for therapeutic Use.
2-Bromo-4-(pyridin-3-yl)thiazole(Cat No.:L033669)is a heterocyclic compound used in pharmaceutical and chemical research. This molecule features a thiazole ring with a bromine atom at the 2-position and a pyridin-3-yl group at the 4-position, making it a valuable intermediate in the synthesis of complex bioactive molecules. It is commonly employed in the development of potential therapeutic agents, including those targeting various diseases. The unique combination of the thiazole and pyridine rings allows for diverse reactivity, supporting advanced research in medicinal chemistry and drug discovery.
CAS Number | 886370-95-2 |
Molecular Formula | C8H5BrN2S |
Purity | ≥95% |
IUPAC Name | 2-bromo-4-pyridin-3-yl-1,3-thiazole |
InChI | InChI=1S/C8H5BrN2S/c9-8-11-7(5-12-8)6-2-1-3-10-4-6/h1-5H |
InChIKey | ITEDZSJFELWCCO-UHFFFAOYSA-N |
SMILES | C1=CC(=CN=C1)C2=CSC(=N2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |