For research use only. Not for therapeutic Use.
2-Bromo-4-tert-butylaniline (Cat.No:M002113) is a chemical compound used as an intermediate in organic synthesis. Its structure features a bromine atom and a tert-butyl group attached to an aniline ring. This compound serves as a versatile building block for creating various organic molecules in pharmaceutical, agrochemical, and material science research.
CAS Number | 103273-01-4 |
Molecular Formula | C10H14BrN |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | 2-bromo-4-tert-butylaniline |
InChI | InChI=1S/C10H14BrN/c1-10(2,3)7-4-5-9(12)8(11)6-7/h4-6H,12H2,1-3H3 |
InChIKey | OLKYFBNIFKQRIZ-UHFFFAOYSA-N |
SMILES | CC(C)(C)C1=CC(=C(C=C1)N)Br |