For research use only. Not for therapeutic Use.
2-Bromo-4,5-dimethyloxazole is a brominated heterocyclic compound commonly used in organic synthesis and pharmaceutical research. Its oxazole ring, substituted with bromine at the 2-position and methyl groups at the 4 and 5 positions, provides unique reactivity for the creation of bioactive molecules. This compound is often employed as a building block or intermediate in the development of drugs, agrochemicals, and fine chemicals. Its versatility in facilitating cross-coupling reactions and other transformations makes it valuable in medicinal chemistry and material science.
CAS Number | 1240612-08-1 |
Synonyms | 2-bromo-4,5-dimethyloxazole |
Molecular Formula | C5H6BrNO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-bromo-4,5-dimethyl-1,3-oxazole |
InChI | InChI=1S/C5H6BrNO/c1-3-4(2)8-5(6)7-3/h1-2H3 |
InChIKey | QDVISYCNCKXBLV-UHFFFAOYSA-N |
SMILES | CC1=C(OC(=N1)Br)C |