For research use only. Not for therapeutic Use.
2-Bromo-5-amino-4-picoline is a valuable intermediate in pharmaceutical research and chemical synthesis. This brominated pyridine derivative is commonly used in the preparation of various heterocyclic compounds and in the development of biologically active molecules. Its structural features make it suitable for diverse reactions, including cross-coupling and substitution processes, facilitating the synthesis of complex organic frameworks. Researchers rely on 2-Bromo-5-amino-4-picoline for its versatility in medicinal chemistry and its role in the discovery of new therapeutic agents.
CAS Number | 156118-16-0 |
Molecular Formula | C6H7BrN2 |
Purity | ≥95% |
Storage | Store at -20 ℃ |
IUPAC Name | 6-bromo-4-methylpyridin-3-amine |
InChI | InChI=1S/C6H7BrN2/c1-4-2-6(7)9-3-5(4)8/h2-3H,8H2,1H3 |
InChIKey | MVDBPMJQCXZKRB-UHFFFAOYSA-N |
SMILES | CC1=CC(=NC=C1N)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |