For research use only. Not for therapeutic Use.
2-Bromo-5-(bromomethyl)thiophene(Cat No.:L007894). It is a chemical compound featuring a thiophene ring substituted with bromine at the 2-position and a bromomethyl group at the 5-position. Thiophene derivatives are essential in the field of materials science, serving as building blocks for organic semiconductors and optoelectronic devices. The presence of bromine atoms enhances its reactivity, making it valuable in various chemical transformations. Compounds like these play a crucial role in the development of advanced materials, contributing to innovations in organic electronics and related technologies for applications in displays, sensors, and solar cells.
CAS Number | 59311-27-2 |
Molecular Formula | C5H4Br2S |
Purity | ≥95% |
IUPAC Name | 2-bromo-5-(bromomethyl)thiophene |
InChI | InChI=1S/C5H4Br2S/c6-3-4-1-2-5(7)8-4/h1-2H,3H2 |
InChIKey | OECAOMHGRQHCGG-UHFFFAOYSA-N |
SMILES | C1=C(SC(=C1)Br)CBr |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |