For research use only. Not for therapeutic Use.
2-Bromo-5-chloro-1,3-thiazole-4-carbonitrile(Cat No.:L007729), is a chemical compound with a heterocyclic structure containing bromine, chlorine, nitrogen, sulfur, and carbon atoms. Compounds featuring thiazole rings are important in medicinal chemistry, often acting as key structural elements in drug design. Researchers use this specific compound as a building block in the synthesis of more complex molecules. Its unique combination of halogen atoms and the thiazole ring provides versatility in organic synthesis, enabling the creation of diverse compounds for pharmaceutical, agricultural, or material science applications.
CAS Number | 1204297-56-2 |
Molecular Formula | C4BrClN2S |
Purity | ≥95% |
IUPAC Name | 2-bromo-5-chloro-1,3-thiazole-4-carbonitrile |
InChI | InChI=1S/C4BrClN2S/c5-4-8-2(1-7)3(6)9-4 |
InChIKey | LXXQTAQGOANSLV-UHFFFAOYSA-N |
SMILES | C(#N)C1=C(SC(=N1)Br)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |