For research use only. Not for therapeutic Use.
2-Bromo-5-chloro-4-iodopyridine(Cat No.:L006823), is a heterocyclic compound containing a pyridine ring substituted with bromine, chlorine, and iodine atoms. This unique chemical structure makes it a valuable intermediate in the synthesis of complex organic molecules, including pharmaceuticals, agrochemicals, and materials with specialized properties. Researchers and chemists utilize its specific halogenation pattern to introduce diverse functionalities in organic synthesis.
Catalog Number | L006823 |
CAS Number | 1061357-88-7 |
Molecular Formula | C5H2BrClIN |
Purity | ≥95% |
IUPAC Name | 2-bromo-5-chloro-4-iodopyridine |
InChI | InChI=1S/C5H2BrClIN/c6-5-1-4(8)3(7)2-9-5/h1-2H |
InChIKey | UPWHKYFBMYMQJC-UHFFFAOYSA-N |
SMILES | C1=C(C(=CN=C1Br)Cl)I |