For research use only. Not for therapeutic Use.
2-Bromo-5-fluoro-4-methoxypyridine is a halogenated pyridine derivative featuring bromine at the 2-position, fluorine at the 5-position, and a methoxy group at the 4-position. This compound is highly valuable in organic synthesis and pharmaceutical research due to its reactivity and functional versatility, enabling the development of complex bioactive molecules. Its unique combination of substituents allows for diverse chemical transformations, making it a useful intermediate in synthesizing drug candidates, agrochemicals, and advanced materials for research applications.
CAS Number | 1256816-36-0 |
Molecular Formula | C6H5BrFNO |
Purity | ≥95% |
IUPAC Name | 2-bromo-5-fluoro-4-methoxypyridine |
InChI | InChI=1S/C6H5BrFNO/c1-10-5-2-6(7)9-3-4(5)8/h2-3H,1H3 |
InChIKey | YALQJBZQRNNIMO-UHFFFAOYSA-N |
SMILES | COC1=CC(=NC=C1F)Br |