For research use only. Not for therapeutic Use.
2-Bromo-5-fluoropyridine 1-oxide(Cat No.:L006712), is a chemical compound featuring a pyridine ring substituted with bromine, fluorine, and an oxygen atom. This compound is significant in organic synthesis and medicinal chemistry, serving as a versatile building block for the creation of various functionalized pyridines. The presence of both bromine and fluorine enhances its reactivity, enabling diverse chemical transformations. Researchers utilize 2-Bromo-5-fluoropyridine 1-oxide as a valuable intermediate, contributing to the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals.
CAS Number | 935534-39-7 |
Molecular Formula | C5H3BrFNO |
Purity | ≥95% |
IUPAC Name | 2-bromo-5-fluoro-1-oxidopyridin-1-ium |
InChI | InChI=1S/C5H3BrFNO/c6-5-2-1-4(7)3-8(5)9/h1-3H |
InChIKey | RDZPKTQDXLFGTQ-UHFFFAOYSA-N |
SMILES | C1=CC(=[N+](C=C1F)[O-])Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |