For research use only. Not for therapeutic Use.
2-Bromo-5-hydroxybenzaldehyde(Cat No.:R042190)is an organic compound featuring a bromine atom and a hydroxyl group on a benzaldehyde framework. This compound is of interest in synthetic organic chemistry due to its reactivity, which allows for various functionalization reactions. It can serve as a building block in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals. The hydroxyl group can participate in hydrogen bonding, enhancing its solubility in polar solvents. Ongoing research explores its potential applications in medicinal chemistry, particularly in developing novel compounds with therapeutic properties.
CAS Number | 2973-80-0 |
Synonyms | 6-Bromo-3-hydroxybenzaldehyde; 5-Hydroxy-2-bromobenzaldehyde |
Molecular Formula | C7H5BrO2 |
Purity | ≥95% |
Storage | Store at +4C |
IUPAC Name | 2-bromo-5-hydroxybenzaldehyde |
InChI | InChI=1S/C7H5BrO2/c8-7-2-1-6(10)3-5(7)4-9/h1-4,10H |
InChIKey | SCRQAWQJSSKCFN-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1O)C=O)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |