For research use only. Not for therapeutic Use.
2-Bromo-5-isopropoxypyridine(CAT: L039610) is a functionalized pyridine derivative with a bromine atom at the 2-position and an isopropoxy group at the 5-position. This compound is commonly used as an intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The bromine atom provides a reactive site for cross-coupling reactions, such as Suzuki or Heck coupling, allowing further modifications. Meanwhile, the isopropoxy group adds lipophilicity and can enhance the compound’s ability to interact with biological targets. Due to its versatile reactivity, this compound is valuable in synthesizing bioactive molecules, making it useful in medicinal chemistry for developing potential therapeutic agents.
CAS Number | 857992-23-5 |
Molecular Formula | C8H10BrNO |
Purity | ≥95% |
IUPAC Name | 2-bromo-5-propan-2-yloxypyridine |
InChI | InChI=1S/C8H10BrNO/c1-6(2)11-7-3-4-8(9)10-5-7/h3-6H,1-2H3 |
InChIKey | CUYHLTYVNBUNMW-UHFFFAOYSA-N |