For research use only. Not for therapeutic Use.
2-Bromo-5-methylpyridine-1-oxide(CAT: M136660) is a high-purity heterocyclic compound featuring a bromine atom at the 2nd position and a methyl group at the 5th position on a pyridine-1-oxide ring. This versatile molecule is a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its unique structure allows for functionalization in diverse chemical reactions, making it a key building block in the design of bioactive molecules and advanced materials. With excellent stability and reactivity, 2-Bromo-5-methylpyridine-1-oxide supports innovative research and development in medicinal chemistry and fine chemical production.
CAS Number | 19230-58-1 |
Molecular Formula | C6H6BrNO |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 2-bromo-5-methyl-1-oxidopyridin-1-ium |
InChI | InChI=1S/C6H6BrNO/c1-5-2-3-6(7)8(9)4-5/h2-4H,1H3 |
InChIKey | PJPYKXAQHIYIFY-UHFFFAOYSA-N |
SMILES | CC1=C[N+](=C(C=C1)Br)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |