For research use only. Not for therapeutic Use.
2-Bromo-5-nitrobenzaldehyde is an aromatic compound featuring both a bromine atom and a nitro group at the 2nd and 5th positions of a benzaldehyde ring. This compound is of interest in organic synthesis due to its reactive aldehyde, bromine, and nitro functional groups, making it a valuable intermediate for creating more complex molecules. It is commonly used in the development of pharmaceuticals, agrochemicals, and dyes, and researchers explore its potential in various cross-coupling and substitution reactions for further functionalization.
CAS Number | 20357-20-4 |
Synonyms | 5-Bromo-2-nitrobenzaldehyde; NSC 107452 |
Molecular Formula | C7H4BrNO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5-bromo-2-nitrobenzaldehyde |
InChI | InChI=1S/C7H4BrNO3/c8-6-1-2-7(9(11)12)5(3-6)4-10/h1-4H |
InChIKey | UFRVBZVJVRHSNR-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1Br)C=O)[N+](=O)[O-] |