For research use only. Not for therapeutic Use.
2-Bromo-5-nitropyrazine (Cat.No:M022754) is a chemical compound used as a building block in organic synthesis. It serves as a versatile intermediate in the preparation of pharmaceuticals and agrochemicals. Its bromo and nitro functional groups make it valuable for creating diverse molecules with specific properties, aiding in research and industry applications.
CAS Number | 117103-53-4 |
Synonyms | 2-Bromo-5-nitropyrazine |
Molecular Formula | C4H2BrN3O2 |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | 2-bromo-5-nitropyrazine |
InChI | InChI=1S/C4H2BrN3O2/c5-3-1-7-4(2-6-3)8(9)10/h1-2H |
InChIKey | AODWTNYHOYDRJJ-UHFFFAOYSA-N |
SMILES | C1=C(N=CC(=N1)Br)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |