Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 2-Bromo-5-(piperidin-1-YL)pyridine
For research use only. Not for therapeutic Use.
2-Bromo-5-(piperidine-1-yl)pyridine(Cat No.:L019690), is a chemical compound used in organic synthesis and pharmaceutical research. It is a pyridine derivative with a bromine atom at position 2 and a piperidine-1-yl group attached to position 5 of the pyridine ring. This versatile compound serves as a crucial intermediate in synthesizing various organic molecules and pharmaceutical agents, making it valuable in drug development and medicinal chemistry research.
CAS Number | 1142197-44-1 |
Molecular Formula | C10H13BrN2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 2-bromo-5-piperidin-1-ylpyridine |
InChI | InChI=1S/C10H13BrN2/c11-10-5-4-9(8-12-10)13-6-2-1-3-7-13/h4-5,8H,1-3,6-7H2 |
InChIKey | CEDLKQCTSNPLGZ-UHFFFAOYSA-N |
SMILES | C1CCN(CC1)C2=CN=C(C=C2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |