For research use only. Not for therapeutic Use.
2-Bromo-5,6-dimethoxy-3-methylpyridine is a halogenated pyridine derivative used in pharmaceutical research and organic synthesis. Its structure, featuring bromine at the 2-position, methoxy groups at the 5 and 6 positions, and a methyl group at the 3-position, makes it a versatile building block for creating bioactive molecules. This compound is valuable in the synthesis of therapeutic agents and complex heterocyclic compounds. Its reactivity allows for various chemical modifications, contributing to advancements in medicinal chemistry and drug development.
CAS Number | 64837-91-8 |
Molecular Formula | C8H10BrNO2 |
Purity | ≥95% |
IUPAC Name | 2-bromo-5,6-dimethoxy-3-methylpyridine |
InChI | InChI=1S/C8H10BrNO2/c1-5-4-6(11-2)8(12-3)10-7(5)9/h4H,1-3H3 |
InChIKey | XQHPLQOOHHDFDO-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |