For research use only. Not for therapeutic Use.
2-Bromo-5H-cyclopenta[b]pyridin-7(6H)-one(CAT: L048803) is a brominated heterocyclic compound with significant utility in pharmaceutical and organic synthesis. Its structure features a cyclopenta[b]pyridine ring system with a bromine atom at the 2-position and a ketone group at the 7-position, providing unique reactivity and functional versatility. This compound serves as a critical intermediate in the synthesis of bioactive molecules, including inhibitors and modulators targeting key biological pathways. The bromine substituent facilitates cross-coupling reactions, enabling further functionalization. Researchers use 2-Bromo-5H-cyclopenta[b]pyridin-7(6H)-one in medicinal chemistry and structure-activity relationship (SAR) studies, contributing to the development of novel therapeutic agents.
CAS Number | 1256823-72-9 |
Molecular Formula | C8H6BrNO |
Purity | ≥95% |
IUPAC Name | 2-bromo-5,6-dihydrocyclopenta[b]pyridin-7-one |
InChI | InChI=1S/C8H6BrNO/c9-7-4-2-5-1-3-6(11)8(5)10-7/h2,4H,1,3H2 |
InChIKey | NRMWRJIKUYDPDZ-UHFFFAOYSA-N |
SMILES | 1CC(=O)C2=C1C=CC(=N2)Br |